CAS 1516860-25-5 is the registry number for Macitentan Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-bromophenyl)-4,6-dichloropyrimidine (CAS 1516860-25-5) is a chemical compound with the molecular formula C10H5BrCl2N2 and a molecular weight of 303.97 g/mol. IUPAC name: 5-(2-bromophenyl)-4,6-dichloropyrimidine. InChIKey: DCAQCDUVMFFKKE-UHFFFAOYSA-N.
| Molecular formula | C10H5BrCl2N2 |
|---|---|
| Molecular weight | 303.97 g/mol |
| IUPAC name | 5-(2-bromophenyl)-4,6-dichloropyrimidine |
| InChIKey | DCAQCDUVMFFKKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(N=CN=C2Cl)Cl)Br |
Computed by PubChem (NCBI)