CAS 1490189-81-5 appears in our catalog under these names: 4-(4-Bromophenyl)-2,6-dichloropyrimidine, 95%, 4-(4-Bromophenyl)-2,6-dichloropyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(4-bromophenyl)-2,6-dichloropyrimidine (CAS 1490189-81-5) is a chemical compound with the molecular formula C10H5BrCl2N2 and a molecular weight of 303.97 g/mol. IUPAC name: 4-(4-bromophenyl)-2,6-dichloropyrimidine. InChIKey: YCFQUQJADBOSAN-UHFFFAOYSA-N.
| Molecular formula | C10H5BrCl2N2 |
|---|---|
| Molecular weight | 303.97 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2,6-dichloropyrimidine |
| InChIKey | YCFQUQJADBOSAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC(=N2)Cl)Cl)Br |
Computed by PubChem (NCBI)