Products 1465908-73-9
CAS 1465908-73-9 appears in our catalog under these names: Tasipimidine sulfate, Tasipimidine (sulfate), 99.32%, 2-(3,4-Dihydro-5-methoxy-1H-2-benzopyran-1-yl)-4,5-dihydro-1H-imidazole, sulfate, 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 25 mg, 100 mg, 5 mg, 50 mg, 10mM/1mL.
2-(5-methoxy-3,4-dihydro-1H-isochromen-1-yl)-4,5-dihydro-1H-imidazole;sulfuric acid (CAS 1465908-73-9) is a chemical compound with the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. IUPAC name: 2-(5-methoxy-3,4-dihydro-1H-isochromen-1-yl)-4,5-dihydro-1H-imidazole;sulfuric acid. InChIKey: HZWPSPYSMWTZTG-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O6S |
|---|---|
| Molecular weight | 330.36 g/mol |
| IUPAC name | 2-(5-methoxy-3,4-dihydro-1H-isochromen-1-yl)-4,5-dihydro-1H-imidazole;sulfuric acid |
| InChIKey | HZWPSPYSMWTZTG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1CCOC2C3=NCCN3.OS(=O)(=O)O |
Computed by PubChem (NCBI)