Products 2137030-54-5
CAS 2137030-54-5 is the registry number for Methyl (2S)-2-{((benzyloxy)carbonyl)amino}-4-sulfamoylbutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (2S)-2-(phenylmethoxycarbonylamino)-4-sulfamoylbutanoate (CAS 2137030-54-5) is a chemical compound with the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. IUPAC name: methyl (2S)-2-(phenylmethoxycarbonylamino)-4-sulfamoylbutanoate. InChIKey: TYCPVVFRQFBFSZ-NSHDSACASA-N.
| Molecular formula | C13H18N2O6S |
|---|---|
| Molecular weight | 330.36 g/mol |
| IUPAC name | methyl (2S)-2-(phenylmethoxycarbonylamino)-4-sulfamoylbutanoate |
| InChIKey | TYCPVVFRQFBFSZ-NSHDSACASA-N |
| SMILES | COC(=O)[C@H](CCS(=O)(=O)N)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)