CAS 1466546-50-8 is the registry number for 6,7-Dichloro-2-oxo-2H-chromene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-2-oxochromene-3-carboxylic acid (CAS 1466546-50-8) is a chemical compound with the molecular formula C10H4Cl2O4 and a molecular weight of 259.04 g/mol. IUPAC name: 6,7-dichloro-2-oxochromene-3-carboxylic acid. InChIKey: GDGAUSHWDKPMLY-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2O4 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | 6,7-dichloro-2-oxochromene-3-carboxylic acid |
| InChIKey | GDGAUSHWDKPMLY-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=O)OC2=CC(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)