Products 1466546-50-8

CAS 1466546-50-8 is the registry number for 6,7-Dichloro-2-oxo-2H-chromene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6,7-dichloro-2-oxochromene-3-carboxylic acid (CAS 1466546-50-8) is a chemical compound with the molecular formula C10H4Cl2O4 and a molecular weight of 259.04 g/mol. IUPAC name: 6,7-dichloro-2-oxochromene-3-carboxylic acid. InChIKey: GDGAUSHWDKPMLY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H4Cl2O4
Molecular weight259.04 g/mol
IUPAC name6,7-dichloro-2-oxochromene-3-carboxylic acid
InChIKeyGDGAUSHWDKPMLY-UHFFFAOYSA-N
SMILESC1=C2C=C(C(=O)OC2=CC(=C1Cl)Cl)C(=O)O

Computed by PubChem (NCBI)