CAS 2199-86-2 appears in our catalog under these names: 6,8-Dichloro-2-oxo-2H-chromene-3-carboxylic acid, 97%, 6,8-Dichloro-2-oxo-2H-chromene-3-carboxylic acid, 95%+ . Offered by: AmBeed, Thermo Scientific. Available pack sizes: 1g, 250MG.
6,8-dichloro-2-oxochromene-3-carboxylic acid (CAS 2199-86-2) is a chemical compound with the molecular formula C10H4Cl2O4 and a molecular weight of 259.04 g/mol. IUPAC name: 6,8-dichloro-2-oxochromene-3-carboxylic acid. InChIKey: WJEHZKIVHXRVSR-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2O4 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | 6,8-dichloro-2-oxochromene-3-carboxylic acid |
| InChIKey | WJEHZKIVHXRVSR-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=O)OC2=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)