Products 14918-69-5
CAS 14918-69-5 appears in our catalog under these names: 2,3-Dichloro-5,8-dihydroxy-1,4-naphthoquinone, 2,3–Dichloro–5,8–dihydroxy–1,4–naphthoquinone, 2,3-Dichloro-5,8-dihydroxy-1,4-naphthalenedione, 2,3-Dichloro-5,8-dihydroxy-1,4-naphthoquinone, >97.0%(HPLC)(T), 2,3-Dichloro-5,8-dihydroxynaphthalene-1,4-dione 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 1g, 500mg, 250mg, 5g, 1000mg, 2000mg, 10g.
2,3-dichloro-5,8-dihydroxynaphthalene-1,4-dione (CAS 14918-69-5) is a chemical compound with the molecular formula C10H4Cl2O4 and a molecular weight of 259.04 g/mol. IUPAC name: 2,3-dichloro-5,8-dihydroxynaphthalene-1,4-dione. InChIKey: UVESKDKGJSABKP-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2O4 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | 2,3-dichloro-5,8-dihydroxynaphthalene-1,4-dione |
| InChIKey | UVESKDKGJSABKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1O)C(=O)C(=C(C2=O)Cl)Cl)O |
Computed by PubChem (NCBI)