Products 146693-08-5

CAS 146693-08-5 is the registry number for Methyl 2-amino-3-(4-cyanophenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-(4-cyanophenyl)propanoate;hydrochloride (CAS 146693-08-5) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: methyl 2-amino-3-(4-cyanophenyl)propanoate;hydrochloride. InChIKey: YFOWBJYJUKOPDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClN2O2
Molecular weight240.68 g/mol
IUPAC namemethyl 2-amino-3-(4-cyanophenyl)propanoate;hydrochloride
InChIKeyYFOWBJYJUKOPDZ-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CC=C(C=C1)C#N)N.Cl

Computed by PubChem (NCBI)