CAS 146738-87-6 is the registry number for 6-Chloro-1,3-dimethyl-3,4-dihydroquinoxalin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1,3-dimethyl-3,4-dihydroquinoxalin-2-one (CAS 146738-87-6) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 6-chloro-1,3-dimethyl-3,4-dihydroquinoxalin-2-one. InChIKey: ROVHYFUOQAWGRR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 6-chloro-1,3-dimethyl-3,4-dihydroquinoxalin-2-one |
| InChIKey | ROVHYFUOQAWGRR-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(C2=C(N1)C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)