CAS 14676-52-9 appears in our catalog under these names: 2-([1,1'-Biphenyl]-2-yl)acetic acid, 98%, 98%, Biphenyl-2-ylacetic acid, 98%, 2-([1,1'-Biphenyl]-2-yl)acetic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2-phenylphenyl)acetic acid (CAS 14676-52-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 2-(2-phenylphenyl)acetic acid. InChIKey: YWPABLWXCWUIIT-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 2-(2-phenylphenyl)acetic acid |
| InChIKey | YWPABLWXCWUIIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2CC(=O)O |
Computed by PubChem (NCBI)