Products 14681-20-0
CAS 14681-20-0 is the registry number for 2,6-di-tert-Butyl-4-(1-hydroxyethyl)phenol, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
2,6-ditert-butyl-4-(1-hydroxyethyl)phenol (CAS 14681-20-0) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. IUPAC name: 2,6-ditert-butyl-4-(1-hydroxyethyl)phenol. InChIKey: NUFOVXSBOOYABN-UHFFFAOYSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 250.38 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-(1-hydroxyethyl)phenol |
| InChIKey | NUFOVXSBOOYABN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)O |
Computed by PubChem (NCBI)