Products 146887-37-8
CAS 146887-37-8 appears in our catalog under these names: Fenbuconazole-lactone A R-9129, Fenbuconazole-lactone A R-9129, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg, 5mg.
(3S,5R)-5-(4-chlorophenyl)-3-phenyl-3-(1,2,4-triazol-1-ylmethyl)oxolan-2-one (CAS 146887-37-8) is a chemical compound with the molecular formula C19H16ClN3O2 and a molecular weight of 353.8 g/mol. IUPAC name: (3S,5R)-5-(4-chlorophenyl)-3-phenyl-3-(1,2,4-triazol-1-ylmethyl)oxolan-2-one. InChIKey: MHNWNPDHEYZMGW-IEBWSBKVSA-N.
| Molecular formula | C19H16ClN3O2 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | (3S,5R)-5-(4-chlorophenyl)-3-phenyl-3-(1,2,4-triazol-1-ylmethyl)oxolan-2-one |
| InChIKey | MHNWNPDHEYZMGW-IEBWSBKVSA-N |
| SMILES | C1[C@@H](OC(=O)[C@]1(CN2C=NC=N2)C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
Fenbuconazole-lactone A R-9129