CAS 2616820-31-4 is the registry number for 1-(3-(Benzyloxy)phenyl)-3-(2-chloropyridin-4-yl)urea. Offered by: TRC. Available pack sizes: 100mg.
1-(2-chloro-4-pyridinyl)-3-(3-phenylmethoxyphenyl)urea (CAS 2616820-31-4) is a chemical compound with the molecular formula C19H16ClN3O2 and a molecular weight of 353.8 g/mol. IUPAC name: 1-(2-chloro-4-pyridinyl)-3-(3-phenylmethoxyphenyl)urea. InChIKey: NFESTQATQXUKRG-UHFFFAOYSA-N.
| Molecular formula | C19H16ClN3O2 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 1-(2-chloro-4-pyridinyl)-3-(3-phenylmethoxyphenyl)urea |
| InChIKey | NFESTQATQXUKRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)NC(=O)NC3=CC(=NC=C3)Cl |
Computed by PubChem (NCBI)