Products 146887-38-9
CAS 146887-38-9 appears in our catalog under these names: Fenbuconazole-lactone B R-9130, Fenbuconazole-lactone B RH-9130, Fenbuconazole-lactone B R-9130, >95% (HPLC). Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg.
(3S,5S)-5-(4-chlorophenyl)-3-phenyl-3-(1,2,4-triazol-1-ylmethyl)oxolan-2-one (CAS 146887-38-9) is a chemical compound with the molecular formula C19H16ClN3O2 and a molecular weight of 353.8 g/mol. IUPAC name: (3S,5S)-5-(4-chlorophenyl)-3-phenyl-3-(1,2,4-triazol-1-ylmethyl)oxolan-2-one. InChIKey: MHNWNPDHEYZMGW-PKOBYXMFSA-N.
| Molecular formula | C19H16ClN3O2 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | (3S,5S)-5-(4-chlorophenyl)-3-phenyl-3-(1,2,4-triazol-1-ylmethyl)oxolan-2-one |
| InChIKey | MHNWNPDHEYZMGW-PKOBYXMFSA-N |
| SMILES | C1[C@H](OC(=O)[C@]1(CN2C=NC=N2)C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)