CAS 146912-63-2 appears in our catalog under these names: 2-(S)-Hydroxy-4-oxo-4-phenylbutyric Acid, 2-(S)-Hydroxy-4-oxo-4-phenylbutyric acid, min. 95 %, 50 mg, 2-(S)-Hydroxy-4-oxo-4-phenylbutyric acid, min. 95 %, 25 mg, 2-(S)-Hydroxy-4-oxo-4-phenylbutyric acid, min. 95 %, 100 mg, 2-(S)-Hydroxy-4-oxo-4-phenylbutyric acid, min. 95 %, 250 mg. Offered by: TRC, Biosynth, Roth. Available pack sizes: 100mg, 50mg, 25mg, 500mg, 250mg.
(2S)-2-hydroxy-4-oxo-4-phenylbutanoic acid (CAS 146912-63-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (2S)-2-hydroxy-4-oxo-4-phenylbutanoic acid. InChIKey: COFAOIWBTJSSPD-VIFPVBQESA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2S)-2-hydroxy-4-oxo-4-phenylbutanoic acid |
| InChIKey | COFAOIWBTJSSPD-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)