CAS 146924-94-9 appears in our catalog under these names: Docetaxel Impurity 14, (3R,4S)-3-Hydroxy-1-(4-methoxyphenyl)-4-phenyl-2-azetidinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3-hydroxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one (CAS 146924-94-9) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 3-hydroxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one. InChIKey: FTOHXQPVCMMHRO-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 3-hydroxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
| InChIKey | FTOHXQPVCMMHRO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(C(C2=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)