Products 146946-10-3
CAS 146946-10-3 is the registry number for 6-amino-1,3-diethyl-5-nitropyrimidine-2,4(1H,3H)-dione. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-1,3-diethyl-5-nitropyrimidine-2,4-dione (CAS 146946-10-3) is a chemical compound with the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. IUPAC name: 6-amino-1,3-diethyl-5-nitropyrimidine-2,4-dione. InChIKey: DXUHIVYXIQSQRL-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O4 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 6-amino-1,3-diethyl-5-nitropyrimidine-2,4-dione |
| InChIKey | DXUHIVYXIQSQRL-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=O)N(C1=O)CC)[N+](=O)[O-])N |
Computed by PubChem (NCBI)