Products 1794768-19-6
CAS 1794768-19-6 appears in our catalog under these names: 4-Amino-5-((ethoxycarbonyl)amino)-1-methyl-d3 Uracil, 4–Amino–5–((ethoxycarbonyl)amino)–1–methyl–d3 Uracil. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg, 50mg.
Ethyl N-[6-amino-2,4-dioxo-3-(trideuteriomethyl)-1H-pyrimidin-5-yl]carbamate (CAS 1794768-19-6) is a chemical compound with the molecular formula C8H12N4O4 and a molecular weight of 231.22 g/mol. IUPAC name: ethyl N-[6-amino-2,4-dioxo-3-(trideuteriomethyl)-1H-pyrimidin-5-yl]carbamate. InChIKey: OJERWLCKFBQUEA-BMSJAHLVSA-N.
| Molecular formula | C8H12N4O4 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | ethyl N-[6-amino-2,4-dioxo-3-(trideuteriomethyl)-1H-pyrimidin-5-yl]carbamate |
| InChIKey | OJERWLCKFBQUEA-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C(=C(NC1=O)N)NC(=O)OCC |
Computed by PubChem (NCBI)