CAS 40372-06-3 is the registry number for 2'-Deoxyribavirin. Offered by: TRC. Available pack sizes: 25mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide (CAS 40372-06-3) is a chemical compound with the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide. InChIKey: GODSJHAJEWFDAD-KVQBGUIXSA-N.
| Molecular formula | C8H12N4O4 |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| InChIKey | GODSJHAJEWFDAD-KVQBGUIXSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC(=N2)C(=O)N)CO)O |
Computed by PubChem (NCBI)