Products 147-47-7
CAS 147-47-7 appears in our catalog under these names: 1,2-Dihydro-2,2,4-trimethylquinoline (>85%), >95% (HPLC), 2,2,4–Trimethyl–1,2–dihydroquinoline, 2,2,4-Trimethyl-1,2-dihydroquinoline, 1,2-Dihydro-2,2,4-trimethylquinoline 93%, 2，2，4-Trimethyl-1，2-dihydroquinoline, 95%+, 95%+. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 25g, 100g, 50g, 250g, 500g, 1000g, 1g.
2,2,4-trimethyl-1H-quinoline (CAS 147-47-7) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 2,2,4-trimethyl-1H-quinoline. InChIKey: ZNRLMGFXSPUZNR-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 2,2,4-trimethyl-1H-quinoline |
| InChIKey | ZNRLMGFXSPUZNR-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=CC=CC=C12)(C)C |
Computed by PubChem (NCBI)