Products 147058-27-3
CAS 147058-27-3 appears in our catalog under these names: Docetaxel Impurity 49, Docetaxel Impurity 46, Docetaxel Impurity 44. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2R,3S)-2-hydroxy-3-phenyl-3-[[(1S)-1-phenylethyl]amino]propanoate (CAS 147058-27-3) is a chemical compound with the molecular formula C18H21NO3 and a molecular weight of 299.4 g/mol. IUPAC name: methyl (2R,3S)-2-hydroxy-3-phenyl-3-[[(1S)-1-phenylethyl]amino]propanoate. InChIKey: CCUHNAGNTZGTTF-RRQGHBQHSA-N.
| Molecular formula | C18H21NO3 |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | methyl (2R,3S)-2-hydroxy-3-phenyl-3-[[(1S)-1-phenylethyl]amino]propanoate |
| InChIKey | CCUHNAGNTZGTTF-RRQGHBQHSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N[C@@H](C2=CC=CC=C2)[C@H](C(=O)OC)O |
Computed by PubChem (NCBI)