CAS 147091-71-2 is the registry number for (R)–Methyl 2–((tert–butoxycarbonyl)amino)–3–cyanopropanoate. Offered by: GLPBio. Available pack sizes: 1g.
Methyl (2R)-3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 147091-71-2) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: methyl (2R)-3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: LXOOXGNHKNWNLH-SSDOTTSWSA-N.
| Molecular formula | C10H16N2O4 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | methyl (2R)-3-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | LXOOXGNHKNWNLH-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC#N)C(=O)OC |
Computed by PubChem (NCBI)