CAS 58477-85-3 appears in our catalog under these names: N,N'-Diallyl-l-tartardiamide, 98%, (+)–N,N'–Diallyl–L–tartardiamide, N,N'-Diallyl-L-tartardiamide, 99% , N,N'-Diallyl-L-tartardiamide, (+)-N,N'-Diallyl-L-tartardiamide, >98.0%(T)(HPLC). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 100g, 5g, 1g, 50g, 250g, 500g, 1000g.
(2R,3R)-2,3-dihydroxy-N,N'-bis(prop-2-enyl)butanediamide (CAS 58477-85-3) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxy-N,N'-bis(prop-2-enyl)butanediamide. InChIKey: ZRKLEAHGBNDKHM-HTQZYQBOSA-N.
| Molecular formula | C10H16N2O4 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxy-N,N'-bis(prop-2-enyl)butanediamide |
| InChIKey | ZRKLEAHGBNDKHM-HTQZYQBOSA-N |
| SMILES | C=CCNC(=O)[C@@H]([C@H](C(=O)NCC=C)O)O |
Computed by PubChem (NCBI)