CAS 2270906-77-7 is the registry number for 4-Nitro-3,6-dihydro-2h-pyridine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 4-nitro-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 2270906-77-7) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: tert-butyl 4-nitro-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: WDZBNWKLJGVIJN-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O4 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | tert-butyl 4-nitro-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | WDZBNWKLJGVIJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CC1)[N+](=O)[O-] |
Computed by PubChem (NCBI)