Products 2270906-77-7

CAS 2270906-77-7 is the registry number for 4-Nitro-3,6-dihydro-2h-pyridine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-nitro-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 2270906-77-7) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: tert-butyl 4-nitro-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: WDZBNWKLJGVIJN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16N2O4
Molecular weight228.24 g/mol
IUPAC nametert-butyl 4-nitro-3,6-dihydro-2H-pyridine-1-carboxylate
InChIKeyWDZBNWKLJGVIJN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=CC1)[N+](=O)[O-]

Computed by PubChem (NCBI)