CAS 147103-93-3 appears in our catalog under these names: Cefprozil EP Impurity C (Cefadroxil EP Impurity E), Cefprozil Impurity 7, 3-(Aminomethylene)-6-(4-hydroxyphenyl)piperazine-2,5-dione, 98%, Cefadroxil Impurity 5(Cefadroxil EP Impurity E), Cefprozil EP impurity C. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
(3E)-3-(aminomethylidene)-6-(4-hydroxyphenyl)piperazine-2,5-dione (CAS 147103-93-3) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: (3E)-3-(aminomethylidene)-6-(4-hydroxyphenyl)piperazine-2,5-dione. InChIKey: OUXGVNPOYJAFHP-VMPITWQZSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (3E)-3-(aminomethylidene)-6-(4-hydroxyphenyl)piperazine-2,5-dione |
| InChIKey | OUXGVNPOYJAFHP-VMPITWQZSA-N |
| SMILES | C1=CC(=CC=C1C2C(=O)N/C(=C/N)/C(=O)N2)O |
Computed by PubChem (NCBI)