Products 1471259-00-3
CAS 1471259-00-3 is the registry number for Ethyl 2-(1-methyl-1H-indazol-5-yl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(1-methylindazol-5-yl)-2-oxoacetate (CAS 1471259-00-3) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 2-(1-methylindazol-5-yl)-2-oxoacetate. InChIKey: HYTPSPLEFIIMNR-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | ethyl 2-(1-methylindazol-5-yl)-2-oxoacetate |
| InChIKey | HYTPSPLEFIIMNR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC2=C(C=C1)N(N=C2)C |
Computed by PubChem (NCBI)