CAS 147145-16-2 is the registry number for U 93385. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide (CAS 147145-16-2) is a chemical compound with the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. IUPAC name: (3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide. InChIKey: JSZBRMZCAIJCKB-TZMCWYRMSA-N.
| Molecular formula | C16H22N2O |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | (3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide |
| InChIKey | JSZBRMZCAIJCKB-TZMCWYRMSA-N |
| SMILES | CCCN1CC[C@@H]2[C@H]1CCC3=C2C(=CC=C3)C(=O)N |
Computed by PubChem (NCBI)