CAS 147217-79-6 is the registry number for BDE NO 36 SOLUTION OEKANAL, 505G/ML IN I. Offered by: Sigma-Aldrich. Available pack sizes: 1ML.
1,3-dibromo-5-(3-bromophenoxy)benzene (CAS 147217-79-6) is a chemical compound with the molecular formula C12H7Br3O and a molecular weight of 406.89 g/mol. IUPAC name: 1,3-dibromo-5-(3-bromophenoxy)benzene. InChIKey: XUKPJLVONRTECE-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3O |
|---|---|
| Molecular weight | 406.89 g/mol |
| IUPAC name | 1,3-dibromo-5-(3-bromophenoxy)benzene |
| InChIKey | XUKPJLVONRTECE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OC2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)