Products 147217-79-6

CAS 147217-79-6 is the registry number for BDE NO 36 SOLUTION OEKANAL, 505G/ML IN I. Offered by: Sigma-Aldrich. Available pack sizes: 1ML.

Structural formula: {0} (CAS {1})

1,3-dibromo-5-(3-bromophenoxy)benzene (CAS 147217-79-6) is a chemical compound with the molecular formula C12H7Br3O and a molecular weight of 406.89 g/mol. IUPAC name: 1,3-dibromo-5-(3-bromophenoxy)benzene. InChIKey: XUKPJLVONRTECE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7Br3O
Molecular weight406.89 g/mol
IUPAC name1,3-dibromo-5-(3-bromophenoxy)benzene
InChIKeyXUKPJLVONRTECE-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Br)OC2=CC(=CC(=C2)Br)Br

Computed by PubChem (NCBI)