CAS 337513-56-1 is the registry number for 1,2,4-Tribromo-5-phenoxybenzene. Offered by: TRC. Available pack sizes: 10mg.
1,2,4-tribromo-5-phenoxybenzene (CAS 337513-56-1) is a chemical compound with the molecular formula C12H7Br3O and a molecular weight of 406.89 g/mol. IUPAC name: 1,2,4-tribromo-5-phenoxybenzene. InChIKey: LTMKAFUXYKEDLR-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3O |
|---|---|
| Molecular weight | 406.89 g/mol |
| IUPAC name | 1,2,4-tribromo-5-phenoxybenzene |
| InChIKey | LTMKAFUXYKEDLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2Br)Br)Br |
Computed by PubChem (NCBI)