Products 4544-71-2
CAS 4544-71-2 is the registry number for 3,4',5-Tribromo-[1,1'-biphenyl]-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dibromo-4-(4-bromophenyl)phenol (CAS 4544-71-2) is a chemical compound with the molecular formula C12H7Br3O and a molecular weight of 406.89 g/mol. IUPAC name: 2,6-dibromo-4-(4-bromophenyl)phenol. InChIKey: CHRLNCWLRQNNGV-UHFFFAOYSA-N.
| Molecular formula | C12H7Br3O |
|---|---|
| Molecular weight | 406.89 g/mol |
| IUPAC name | 2,6-dibromo-4-(4-bromophenyl)phenol |
| InChIKey | CHRLNCWLRQNNGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C(=C2)Br)O)Br)Br |
Computed by PubChem (NCBI)