CAS 1472729-25-1 appears in our catalog under these names: 2-Chloro-4-(dibenzo[b,d]furan-4-yl)-6-phenyl-1,3,5-triazine, 99%, 99%, 2-Chloro-4-dibenzofuran-4-yl-6-phenyl-[1,3,5]triazine, 99%, 2-Chloro-4-(dibenzo[b,d]furan-4-yl)-6-phenyl-1,3,5-triazine, 99%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
2-chloro-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine (CAS 1472729-25-1) is a chemical compound with the molecular formula C21H12ClN3O and a molecular weight of 357.8 g/mol. IUPAC name: 2-chloro-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine. InChIKey: NKLKYZYRMGGYGN-UHFFFAOYSA-N.
| Molecular formula | C21H12ClN3O |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 2-chloro-4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazine |
| InChIKey | NKLKYZYRMGGYGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC=CC4=C3OC5=CC=CC=C45 |
Computed by PubChem (NCBI)