CAS 1618107-00-8 is the registry number for 2-Chloro-4-(dibenzo[b,d]furan-2-yl)-6-phenyl-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine (CAS 1618107-00-8) is a chemical compound with the molecular formula C21H12ClN3O and a molecular weight of 357.8 g/mol. IUPAC name: 2-chloro-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine. InChIKey: SHXRJHODWWVKAQ-UHFFFAOYSA-N.
| Molecular formula | C21H12ClN3O |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 2-chloro-4-dibenzofuran-2-yl-6-phenyl-1,3,5-triazine |
| InChIKey | SHXRJHODWWVKAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC4=C(C=C3)OC5=CC=CC=C54 |
Computed by PubChem (NCBI)