CAS 2142681-84-1 appears in our catalog under these names: 2–Chloro–4–(dibenzo(b,d)furan–3–yl)–6–phenyl–1,3,5–triazine, 2-Chloro-4-(dibenzo[b,d]furan-3-yl)-6-phenyl-1,3,5-triazine, 98%, 98%, 2-Chloro-4-(dibenzo[b,d]furan-3-yl)-6-phenyl-1,3,5-triazine, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10g.
2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine (CAS 2142681-84-1) is a chemical compound with the molecular formula C21H12ClN3O and a molecular weight of 357.8 g/mol. IUPAC name: 2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine. InChIKey: MPIJGSAWPMMKMU-UHFFFAOYSA-N.
| Molecular formula | C21H12ClN3O |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 2-chloro-4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine |
| InChIKey | MPIJGSAWPMMKMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=CC4=C(C=C3)C5=CC=CC=C5O4 |
Computed by PubChem (NCBI)