CAS 147293-13-8 is the registry number for 2-Amino-3-methyl-3H-imidazo(4,5-h)quinoline. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
3-methylimidazo[4,5-h]quinolin-2-amine (CAS 147293-13-8) is a chemical compound with the molecular formula C11H10N4 and a molecular weight of 198.22 g/mol. IUPAC name: 3-methylimidazo[4,5-h]quinolin-2-amine. InChIKey: SGZHQYMPAAWYIT-UHFFFAOYSA-N.
| Molecular formula | C11H10N4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-methylimidazo[4,5-h]quinolin-2-amine |
| InChIKey | SGZHQYMPAAWYIT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C3=C(C=CC=N3)C=C2)N=C1N |
Computed by PubChem (NCBI)