CAS 1473358-11-0 appears in our catalog under these names: 2,5-Di(thiophen-2-yl)benzene-1,4-diamine, 98%, 2,5-Di(thiophen-2-yl)benzene-1,4-diamine, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
2,5-dithiophen-2-ylbenzene-1,4-diamine (CAS 1473358-11-0) is a chemical compound with the molecular formula C14H12N2S2 and a molecular weight of 272.4 g/mol. IUPAC name: 2,5-dithiophen-2-ylbenzene-1,4-diamine. InChIKey: UUINHKZYHDPIOF-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 2,5-dithiophen-2-ylbenzene-1,4-diamine |
| InChIKey | UUINHKZYHDPIOF-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=C(C=C2N)C3=CC=CS3)N |
Computed by PubChem (NCBI)