CAS 19258-20-9 appears in our catalog under these names: 2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,3-benzothiazole, 95%, 2,2'–Bibenzothiazoline, 2,2'-Bibenzothiazoline, >85.0%(T), 2,2'-Bibenzothiazole, 2,2',3,3'-tetrahydro-, ≥85%, ≥85%, 2,2',3,3'-Tetrahydro-2,2'-bibenzo[d]thiazole, ≥85%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 200mg, 250mg.
2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,3-benzothiazole (CAS 19258-20-9) is a chemical compound with the molecular formula C14H12N2S2 and a molecular weight of 272.4 g/mol. IUPAC name: 2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,3-benzothiazole. InChIKey: LYPDJBMOMMJHAR-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,3-benzothiazol-2-yl)-2,3-dihydro-1,3-benzothiazole |
| InChIKey | LYPDJBMOMMJHAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(S2)C3NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)