CAS 2055720-34-6 is the registry number for 2,5-Di(thiophen-3-yl)benzene-1,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-di(thiophen-3-yl)benzene-1,4-diamine (CAS 2055720-34-6) is a chemical compound with the molecular formula C14H12N2S2 and a molecular weight of 272.4 g/mol. IUPAC name: 2,5-di(thiophen-3-yl)benzene-1,4-diamine. InChIKey: BSQMHPSQCRNBBA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 2,5-di(thiophen-3-yl)benzene-1,4-diamine |
| InChIKey | BSQMHPSQCRNBBA-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=CC(=C(C=C2N)C3=CSC=C3)N |
Computed by PubChem (NCBI)