CAS 14736-49-3 appears in our catalog under these names: 2–(2–(Methoxycarbonyl)phenyl)acetic acid, 2-(2-(Methoxycarbonyl)phenyl)acetic acid, 2-(2-(Methoxycarbonyl)phenyl)acetic acid, 98%, 98%, 2-(2-(Methoxycarbonyl)phenyl)acetic acid, 97%, 2-(2-(Methoxycarbonyl)phenyl)acetic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g, 25g, 500mg, 2.5g.
2-(2-methoxycarbonylphenyl)acetic acid (CAS 14736-49-3) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(2-methoxycarbonylphenyl)acetic acid. InChIKey: UFUWTDVWSUXJEH-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-(2-methoxycarbonylphenyl)acetic acid |
| InChIKey | UFUWTDVWSUXJEH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1CC(=O)O |
Computed by PubChem (NCBI)