CAS 147404-72-6 appears in our catalog under these names: Telmisartan Impurity 14, 4'-(Bromomethyl)-(1,1'-biphenyl)-2-carboxamide, >95% (HPLC), 4'-(Bromomethyl)(1,1'-biphenyl)-2-carboxamide, 4'-(Bromomethyl)-(1,1'-biphenyl)-2-carboxamide, 4'-(Bromomethyl)-[1,1'-biphenyl]-2-carboxamide 95%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 10mg, 25mg, 1g, 250mg, Get quote.
2-[4-(bromomethyl)phenyl]benzamide (CAS 147404-72-6) is a chemical compound with the molecular formula C14H12BrNO and a molecular weight of 290.15 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]benzamide. InChIKey: POWXVFIRWRUILN-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO |
|---|---|
| Molecular weight | 290.15 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]benzamide |
| InChIKey | POWXVFIRWRUILN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CBr)C(=O)N |
Computed by PubChem (NCBI)