Products 1474058-89-3
CAS 1474058-89-3 appears in our catalog under these names: Ciprofibrate EP Impurity A, Ciprofibrate impurity A, 98%, 2-(4-Ethenylphenoxy)-2-methyl-propanoic Acid, Ciprofibrate impurity A, Ciprofibrate impurity A. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg.
2-(4-ethenylphenoxy)-2-methylpropanoic acid (CAS 1474058-89-3) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(4-ethenylphenoxy)-2-methylpropanoic acid. InChIKey: IIJBUUJYXSWCGW-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(4-ethenylphenoxy)-2-methylpropanoic acid |
| InChIKey | IIJBUUJYXSWCGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C=C |
Computed by PubChem (NCBI)
Synonyms:
Ciprofibrate impurity A, Ciprofibrate EP Impurity A, 2-Methyl-2-(4-vinylphenoxy)propanoic acid, 2-(4-ethenylphenoxy)-2-methylpropanoic acid, 2-(4-ethenylphenoxy)-2-methyl-propanoic Acid, starbld0000915, orb1694062, Propanoic acid, 2-(4-ethenylphenoxy)-2-methyl-, 2-(4-Ethenylphenoxy)-2-methylpropanoic Acid; Ciprofibrate Imp. A (EP)