CAS 147432-77-7 appears in our catalog under these names: Ontazolast, Ontazolast/ 99.67% (existing batch purity). Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 5 mg.
N-[(1S)-2-cyclohexyl-1-pyridin-2-ylethyl]-5-methyl-1,3-benzoxazol-2-amine (CAS 147432-77-7) is a chemical compound with the molecular formula C21H25N3O and a molecular weight of 335.4 g/mol. IUPAC name: N-[(1S)-2-cyclohexyl-1-pyridin-2-ylethyl]-5-methyl-1,3-benzoxazol-2-amine. InChIKey: RVXKHAITGKBBAC-SFHVURJKSA-N.
| Molecular formula | C21H25N3O |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | N-[(1S)-2-cyclohexyl-1-pyridin-2-ylethyl]-5-methyl-1,3-benzoxazol-2-amine |
| InChIKey | RVXKHAITGKBBAC-SFHVURJKSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=N2)N[C@@H](CC3CCCCC3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)