Products 2349367-50-4
CAS 2349367-50-4 appears in our catalog under these names: ECPLA (solution), ECPLA. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 1mg, 5mg, 5 mg, 1 mg.
(6aR,9R)-N-cyclopropyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 2349367-50-4) is a chemical compound with the molecular formula C21H25N3O and a molecular weight of 335.4 g/mol. IUPAC name: (6aR,9R)-N-cyclopropyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: UNUJKEQFYPYXBK-AUUYWEPGSA-N.
| Molecular formula | C21H25N3O |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (6aR,9R)-N-cyclopropyl-N-ethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | UNUJKEQFYPYXBK-AUUYWEPGSA-N |
| SMILES | CCN(C1CC1)C(=O)[C@H]2CN([C@@H]3CC4=CNC5=CC=CC(=C45)C3=C2)C |
Computed by PubChem (NCBI)