Products 373608-26-5
CAS 373608-26-5 is the registry number for 3-[1-[4-(tert-Butyl)phenyl]-3-(pyridin-3-yl)-1H-pyrazol-5-yl]-1-propanol, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]propan-1-ol (CAS 373608-26-5) is a chemical compound with the molecular formula C21H25N3O and a molecular weight of 335.4 g/mol. IUPAC name: 3-[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]propan-1-ol. InChIKey: FTFQCFSUWUVLGX-UHFFFAOYSA-N.
| Molecular formula | C21H25N3O |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 3-[1-(4-tert-butylphenyl)-3-pyridin-3-ylpyrazol-5-yl]propan-1-ol |
| InChIKey | FTFQCFSUWUVLGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N2C(=CC(=N2)C3=CN=CC=C3)CCCO |
Computed by PubChem (NCBI)