CAS 14756-26-4 appears in our catalog under these names: BRD56491/ 99.67% (existing batch purity), BRD56491, 99.89% ,, 99.89% ,. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
2-(4-methylphenyl)benzo[h]chromen-4-one (CAS 14756-26-4) is a chemical compound with the molecular formula C20H14O2 and a molecular weight of 286.3 g/mol. IUPAC name: 2-(4-methylphenyl)benzo[h]chromen-4-one. InChIKey: AVCQGCNOJZYRJO-UHFFFAOYSA-N.
| Molecular formula | C20H14O2 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 2-(4-methylphenyl)benzo[h]chromen-4-one |
| InChIKey | AVCQGCNOJZYRJO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)