CAS 14757-45-0 is the registry number for 2,6-Dimethyl-1,8-naphthyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-dimethyl-1,8-naphthyridine (CAS 14757-45-0) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: 2,6-dimethyl-1,8-naphthyridine. InChIKey: DMHYFUIQTGCNJS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | 2,6-dimethyl-1,8-naphthyridine |
| InChIKey | DMHYFUIQTGCNJS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C=N2)C |
Computed by PubChem (NCBI)