CAS 147591-62-6 is the registry number for 2-(2-((4-Aminophenyl)thio)ethyl)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(4-aminophenyl)sulfanylethyl]isoindole-1,3-dione (CAS 147591-62-6) is a chemical compound with the molecular formula C16H14N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: 2-[2-(4-aminophenyl)sulfanylethyl]isoindole-1,3-dione. InChIKey: SYHPYRURUTWAPB-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 2-[2-(4-aminophenyl)sulfanylethyl]isoindole-1,3-dione |
| InChIKey | SYHPYRURUTWAPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCSC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)