Products 519167-28-3
CAS 519167-28-3 is the registry number for N-(3-Cyano-4,5,6,7-tetrahydrobenzo[b]thiophen-2-yl)-2-hydroxybenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-hydroxybenzamide (CAS 519167-28-3) is a chemical compound with the molecular formula C16H14N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-hydroxybenzamide. InChIKey: NWUYLJCKNAEWIT-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-hydroxybenzamide |
| InChIKey | NWUYLJCKNAEWIT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=CC=C3O)C#N |
Computed by PubChem (NCBI)