CAS 458550-54-4 appears in our catalog under these names: N-(4-Carbethoxyphenyl)-n-4-(6'-benzothiazole)amine, 95%, Ethyl 4-(benzo(d)thiazol-6-ylamino)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Ethyl 4-(1,3-benzothiazol-6-ylamino)benzoate (CAS 458550-54-4) is a chemical compound with the molecular formula C16H14N2O2S and a molecular weight of 298.4 g/mol. IUPAC name: ethyl 4-(1,3-benzothiazol-6-ylamino)benzoate. InChIKey: FJUDDTILXQRISJ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | ethyl 4-(1,3-benzothiazol-6-ylamino)benzoate |
| InChIKey | FJUDDTILXQRISJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NC2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)