Products 1476-34-2
CAS 1476-34-2 appears in our catalog under these names: Estrone Impurity 12, 6-Keto Estrone, 6-Ketoestrone, ≥95%, ≥95%. Offered by: Hubei YoungXin, TRC, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5mg.
(8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-6,17-dione (CAS 1476-34-2) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-6,17-dione. InChIKey: JOVYPIGRPWIXHQ-ONUSSAAZSA-N.
| Molecular formula | C18H20O3 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-6,17-dione |
| InChIKey | JOVYPIGRPWIXHQ-ONUSSAAZSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC(=O)C4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)