Products 1539277-94-5

CAS 1539277-94-5 is the registry number for (R)-6-Benzyl 1-ethyl 6-azaspiro[2.5]octane-1,6-dicarboxylate, 98+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

6-O-benzyl 2-O-ethyl (2R)-6-azaspiro[2.5]octane-2,6-dicarboxylate (CAS 1539277-94-5) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: 6-O-benzyl 2-O-ethyl (2R)-6-azaspiro[2.5]octane-2,6-dicarboxylate. InChIKey: HPESIWGAJLAFOB-HNNXBMFYSA-N.

Identity
Molecular formulaC18H23NO4
Molecular weight317.4 g/mol
IUPAC name6-O-benzyl 2-O-ethyl (2R)-6-azaspiro[2.5]octane-2,6-dicarboxylate
InChIKeyHPESIWGAJLAFOB-HNNXBMFYSA-N
SMILESCCOC(=O)[C@@H]1CC12CCN(CC2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)